C28H18N4O2 — CID 155028598
2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzofuro[3,2-f][1,3]benzoxazole (PubChem CID 155028598) has the molecular formula C28H18N4O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzofuro[3,2-f][1,3]benzoxazole.
| Compound Name | 2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzofuro[3,2-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 155028598 |
| Molecular Formula | C28H18N4O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-(2,6-diphenyl-1,4-dihydro-1,3,5-triazin-4-yl)-[1]benzofuro[3,2-f][1,3]benzoxazole |
| SMILES | c1ccc(C2=NC(c3nc4cc5c(cc4o3)oc3ccccc35)N=C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C28H18N4O2/c1-3-9-17(10-4-1)25-30-26(18-11-5-2-6-12-18)32-27(31-25)28-29-21-15-20-19-13-7-8-14-22(19)33-23(20)16-24(21)34-28/h1-16,27H,(H,30,31,32) |
| InChIKey | GIFYEHMRALXYCO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |