About N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide
N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 155028673) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
| PubChem CID | 155028673 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)NCCC2=CNCN2)CC1=O |
| InChI | InChI=1S/C11H18N4O2/c1-15-6-8(4-10(15)16)11(17)13-3-2-9-5-12-7-14-9/h5,8,12,14H,2-4,6-7H2,1H3,(H,13,17) |
| InChIKey | JDPJFVAETULLEK-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide?
The IUPAC name of N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide (CID 155028673) is N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide.
What is the SMILES notation for N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide?
The canonical SMILES for N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide is CN1CC(C(=O)NCCC2=CNCN2)CC1=O.
What is the InChIKey of N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide?
The InChIKey is JDPJFVAETULLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-15-6-8(4-10(15)16)11(17)13-3-2-9-5-12-7-14-9/h5,8,12,14H,2-4,6-7H2,1H3,(H,13,17).
What are the key properties of N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide?
N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide has a molecular weight of 238.29 g/mol, XLogP of -1.04, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydro-1H-imidazol-4-yl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide is sourced from PubChem (CID 155028673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).