About N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide
N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide (PubChem CID 155028912) has the molecular formula C9H19N3OS
and a molecular weight of 217.34 g/mol. Its IUPAC name is N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide.
Molecular Properties
| Compound Name | N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide |
| PubChem CID | 155028912 |
| Molecular Formula | C9H19N3OS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide |
| SMILES | CS/C=C(\NC=O)C(N)CCCCN |
| InChI | InChI=1S/C9H19N3OS/c1-14-6-9(12-7-13)8(11)4-2-3-5-10/h6-8H,2-5,10-11H2,1H3,(H,12,13)/b9-6- |
| InChIKey | HANZFFYGRRGEGM-TWGQIWQCSA-N |
| XLogP | 0.39 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide?
The IUPAC name of N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide (CID 155028912) is N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide.
What is the SMILES notation for N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide?
The canonical SMILES for N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide is CS/C=C(\NC=O)C(N)CCCCN.
What is the InChIKey of N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide?
The InChIKey is HANZFFYGRRGEGM-TWGQIWQCSA-N. The full InChI is InChI=1S/C9H19N3OS/c1-14-6-9(12-7-13)8(11)4-2-3-5-10/h6-8H,2-5,10-11H2,1H3,(H,12,13)/b9-6-.
What are the key properties of N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide?
N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide has a molecular weight of 217.34 g/mol, XLogP of 0.39, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-3,7-diamino-1-methylsulfanylhept-1-en-2-yl]formamide is sourced from PubChem (CID 155028912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).