C21H23F3N4O2 — CID 155029145
methyl N-[(11E,15S)-15-amino-9-(trifluoromethyl)-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,11,16,18-heptaen-5-yl]carbamate (PubChem CID 155029145) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is methyl N-[(11E,15S)-15-amino-9-(trifluoromethyl)-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,11,16,18-heptaen-5-yl]carbamate.
| Compound Name | methyl N-[(11E,15S)-15-amino-9-(trifluoromethyl)-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,11,16,18-heptaen-5-yl]carbamate |
|---|---|
| PubChem CID | 155029145 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl N-[(11E,15S)-15-amino-9-(trifluoromethyl)-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,11,16,18-heptaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(C(F)(F)F)C/C=C\CC[C@H](N)c1cc-2ccn1 |
| InChI | InChI=1S/C21H23F3N4O2/c1-30-20(29)27-14-7-8-15-13-9-10-26-18(11-13)16(25)5-3-2-4-6-19(21(22,23)24)28-17(15)12-14/h2,4,7-12,16,19,28H,3,5-6,25H2,1H3,(H,27,29)/b4-2-/t16-,19?/m0/s1 |
| InChIKey | TUUPTCITIIVRKM-HLFHSTAXSA-N |
| XLogP | 5.01 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|