C19H24IN — CID 155029361
5-iodo-2,5,9,13,13-pentamethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),3,6,11,14-pentaene (PubChem CID 155029361) has the molecular formula C19H24IN and a molecular weight of 393.31 g/mol. Its IUPAC name is 5-iodo-2,5,9,13,13-pentamethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),3,6,11,14-pentaene.
| Compound Name | 5-iodo-2,5,9,13,13-pentamethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),3,6,11,14-pentaene |
|---|---|
| PubChem CID | 155029361 |
| Molecular Formula | C19H24IN |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 5-iodo-2,5,9,13,13-pentamethyl-9-azatricyclo[8.5.0.02,8]pentadeca-1(10),3,6,11,14-pentaene |
| SMILES | CN1C2=C(C=CC(C)(C)C=C2)C2(C)C=CC(C)(I)C=CC12 |
| InChI | InChI=1S/C19H24IN/c1-17(2)9-6-14-15(7-10-17)21(5)16-8-11-18(3,20)12-13-19(14,16)4/h6-13,16H,1-5H3 |
| InChIKey | UJGCJWCZNHKNHR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|