C13H14N2O4 — CID 155030123
(5R)-14-hydroxy-13-methoxy-4-oxa-2,9-diazatetracyclo[9.4.0.03,5.05,9]pentadeca-1(15),11,13-trien-10-one (PubChem CID 155030123) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is (5R)-14-hydroxy-13-methoxy-4-oxa-2,9-diazatetracyclo[9.4.0.03,5.05,9]pentadeca-1(15),11,13-trien-10-one.
| Compound Name | (5R)-14-hydroxy-13-methoxy-4-oxa-2,9-diazatetracyclo[9.4.0.03,5.05,9]pentadeca-1(15),11,13-trien-10-one |
|---|---|
| PubChem CID | 155030123 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (5R)-14-hydroxy-13-methoxy-4-oxa-2,9-diazatetracyclo[9.4.0.03,5.05,9]pentadeca-1(15),11,13-trien-10-one |
| SMILES | COc1cc2c(cc1O)NC1O[C@]13CCCN3C2=O |
| InChI | InChI=1S/C13H14N2O4/c1-18-10-5-7-8(6-9(10)16)14-12-13(19-12)3-2-4-15(13)11(7)17/h5-6,12,14,16H,2-4H2,1H3/t12?,13-/m1/s1 |
| InChIKey | IZOHQWXYJZOPHU-ZGTCLIOFSA-N |
| XLogP | 1.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|