C19H38N2 — CID 155030327
N-(4,4-dimethylpent-1-en-2-yl)-4-imino-N,2,6-trimethylnonan-2-amine (PubChem CID 155030327) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is N-(4,4-dimethylpent-1-en-2-yl)-4-imino-N,2,6-trimethylnonan-2-amine.
| Compound Name | N-(4,4-dimethylpent-1-en-2-yl)-4-imino-N,2,6-trimethylnonan-2-amine |
|---|---|
| PubChem CID | 155030327 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | N-(4,4-dimethylpent-1-en-2-yl)-4-imino-N,2,6-trimethylnonan-2-amine |
| SMILES | [H]/N=C(\CC(C)CCC)CC(C)(C)N(C)C(=C)CC(C)(C)C |
| InChI | InChI=1S/C19H38N2/c1-10-11-15(2)12-17(20)14-19(7,8)21(9)16(3)13-18(4,5)6/h15,20H,3,10-14H2,1-2,4-9H3/b20-17+ |
| InChIKey | AXMBAMVMCPNGTB-LVZFUZTISA-N |
| XLogP | 5.88 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|