About 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene
8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene (PubChem CID 155030338) has the molecular formula C9H12BrN
and a molecular weight of 214.11 g/mol. Its IUPAC name is 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene.
Molecular Properties
| Compound Name | 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene |
| PubChem CID | 155030338 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene |
| SMILES | CN1C=CC(Br)=CC2(CC2)C1 |
| InChI | InChI=1S/C9H12BrN/c1-11-5-2-8(10)6-9(7-11)3-4-9/h2,5-6H,3-4,7H2,1H3 |
| InChIKey | UNTWZQFEBAWDFV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene?
The IUPAC name of 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene (CID 155030338) is 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene.
What is the SMILES notation for 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene?
The canonical SMILES for 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene is CN1C=CC(Br)=CC2(CC2)C1.
What is the InChIKey of 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene?
The InChIKey is UNTWZQFEBAWDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN/c1-11-5-2-8(10)6-9(7-11)3-4-9/h2,5-6H,3-4,7H2,1H3.
What are the key properties of 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene?
8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene has a molecular weight of 214.11 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-methyl-5-azaspiro[2.6]nona-6,8-diene is sourced from PubChem (CID 155030338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).