C20H34N2 — CID 155030416
(6E)-6-[[3,3-dimethyl-2-(methylideneamino)cyclohexen-1-yl]methylidene]-N,3-dimethyloct-7-en-1-amine (PubChem CID 155030416) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (6E)-6-[[3,3-dimethyl-2-(methylideneamino)cyclohexen-1-yl]methylidene]-N,3-dimethyloct-7-en-1-amine.
| Compound Name | (6E)-6-[[3,3-dimethyl-2-(methylideneamino)cyclohexen-1-yl]methylidene]-N,3-dimethyloct-7-en-1-amine |
|---|---|
| PubChem CID | 155030416 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (6E)-6-[[3,3-dimethyl-2-(methylideneamino)cyclohexen-1-yl]methylidene]-N,3-dimethyloct-7-en-1-amine |
| SMILES | C=C/C(=C/C1=C(N=C)C(C)(C)CCC1)CCC(C)CCNC |
| InChI | InChI=1S/C20H34N2/c1-7-17(11-10-16(2)12-14-21-5)15-18-9-8-13-20(3,4)19(18)22-6/h7,15-16,21H,1,6,8-14H2,2-5H3/b17-15- |
| InChIKey | VABHJBBQQIWGLU-ICFOKQHNSA-N |
| XLogP | 5.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|