About (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate
(8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate (PubChem CID 15503046) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate.
Molecular Properties
| Compound Name | (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate |
| PubChem CID | 15503046 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1cccc2c1C(=O)CCC2 |
| InChI | InChI=1S/C12H12O3/c1-8(13)15-11-7-3-5-9-4-2-6-10(14)12(9)11/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | YBWJASUWZZWQAF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate?
The IUPAC name of (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate (CID 15503046) is (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate.
What is the SMILES notation for (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate?
The canonical SMILES for (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate is CC(=O)Oc1cccc2c1C(=O)CCC2.
What is the InChIKey of (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate?
The InChIKey is YBWJASUWZZWQAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-8(13)15-11-7-3-5-9-4-2-6-10(14)12(9)11/h3,5,7H,2,4,6H2,1H3.
What are the key properties of (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate?
(8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate has a molecular weight of 204.22 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-oxo-6,7-dihydro-5H-naphthalen-1-yl) acetate is sourced from PubChem (CID 15503046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).