About 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine
4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine (PubChem CID 155030573) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine.
Molecular Properties
| Compound Name | 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine |
| PubChem CID | 155030573 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine |
| SMILES | CC1CN(C2COC2)CCN1C1=CNNC=C1 |
| InChI | InChI=1S/C12H20N4O/c1-10-7-15(12-8-17-9-12)4-5-16(10)11-2-3-13-14-6-11/h2-3,6,10,12-14H,4-5,7-9H2,1H3 |
| InChIKey | JNSOAVRUPHPELH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine?
The IUPAC name of 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine (CID 155030573) is 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine.
What is the SMILES notation for 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine?
The canonical SMILES for 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine is CC1CN(C2COC2)CCN1C1=CNNC=C1.
What is the InChIKey of 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine?
The InChIKey is JNSOAVRUPHPELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O/c1-10-7-15(12-8-17-9-12)4-5-16(10)11-2-3-13-14-6-11/h2-3,6,10,12-14H,4-5,7-9H2,1H3.
What are the key properties of 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine?
4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine has a molecular weight of 236.32 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]-1,2-dihydropyridazine is sourced from PubChem (CID 155030573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).