About (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene
(2-fluoro-3,3,5-trimethylhexan-2-yl)benzene (PubChem CID 155030770) has the molecular formula C15H23F
and a molecular weight of 222.35 g/mol. Its IUPAC name is (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene.
Molecular Properties
| Compound Name | (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene |
| PubChem CID | 155030770 |
| Molecular Formula | C15H23F |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene |
| SMILES | CC(C)CC(C)(C)C(C)(F)c1ccccc1 |
| InChI | InChI=1S/C15H23F/c1-12(2)11-14(3,4)15(5,16)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3 |
| InChIKey | YNYNPLLSPRBJNT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene?
The IUPAC name of (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene (CID 155030770) is (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene.
What is the SMILES notation for (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene?
The canonical SMILES for (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene is CC(C)CC(C)(C)C(C)(F)c1ccccc1.
What is the InChIKey of (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene?
The InChIKey is YNYNPLLSPRBJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F/c1-12(2)11-14(3,4)15(5,16)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3.
What are the key properties of (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene?
(2-fluoro-3,3,5-trimethylhexan-2-yl)benzene has a molecular weight of 222.35 g/mol, XLogP of 4.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-3,3,5-trimethylhexan-2-yl)benzene is sourced from PubChem (CID 155030770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).