C24H24FN7O3 — CID 155030942
[2-[4-[5-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylamino]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] N-ethenylmethanimidate (PubChem CID 155030942) has the molecular formula C24H24FN7O3 and a molecular weight of 477.50 g/mol. Its IUPAC name is [2-[4-[5-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylamino]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] N-ethenylmethanimidate.
| Compound Name | [2-[4-[5-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylamino]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] N-ethenylmethanimidate |
|---|---|
| PubChem CID | 155030942 |
| Molecular Formula | C24H24FN7O3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [2-[4-[5-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylamino]-[1,2,4]triazolo[4,3-c]pyrimidin-8-yl]-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl] N-ethenylmethanimidate |
| SMILES | C=C/N=C/OCC(=O)N1CC=C(c2cnc(NCc3c(F)ccc4c3CCO4)n3cnnc23)CC1 |
| InChI | InChI=1S/C24H24FN7O3/c1-2-26-15-34-13-22(33)31-8-5-16(6-9-31)18-11-27-24(32-14-29-30-23(18)32)28-12-19-17-7-10-35-21(17)4-3-20(19)25/h2-5,11,14-15H,1,6-10,12-13H2,(H,27,28)/b26-15+ |
| InChIKey | ALJJPJYKGJITIG-CVKSISIWSA-N |
| XLogP | 2.61 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|