C16H21N — CID 155030959
(3aR,5S)-5-(4-ethenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 155030959) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (3aR,5S)-5-(4-ethenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | (3aR,5S)-5-(4-ethenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 155030959 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3aR,5S)-5-(4-ethenylphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | C=Cc1ccc([C@H]2CCC3NCC[C@H]3C2)cc1 |
| InChI | InChI=1S/C16H21N/c1-2-12-3-5-13(6-4-12)14-7-8-16-15(11-14)9-10-17-16/h2-6,14-17H,1,7-11H2/t14-,15-,16?/m0/s1 |
| InChIKey | UALFKTPAYWIFPX-KSCSMHSMSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |