C11H20N2 — CID 155031063
1-[(3Z,6Z)-2,5-dimethylocta-1,3,6-trien-3-yl]-2-methylhydrazine (PubChem CID 155031063) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-[(3Z,6Z)-2,5-dimethylocta-1,3,6-trien-3-yl]-2-methylhydrazine.
| Compound Name | 1-[(3Z,6Z)-2,5-dimethylocta-1,3,6-trien-3-yl]-2-methylhydrazine |
|---|---|
| PubChem CID | 155031063 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-[(3Z,6Z)-2,5-dimethylocta-1,3,6-trien-3-yl]-2-methylhydrazine |
| SMILES | C=C(C)/C(=C/C(C)/C=C\C)NNC |
| InChI | InChI=1S/C11H20N2/c1-6-7-10(4)8-11(9(2)3)13-12-5/h6-8,10,12-13H,2H2,1,3-5H3/b7-6-,11-8- |
| InChIKey | ZEOIOAGCVZBQSI-NJMVCRMVSA-N |
| XLogP | 2.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|