C42H52FN5O5 — CID 155031266
3-[6-[4-[[1-[4-(6-fluoro-6-phenylmethoxyhexan-2-yl)phenyl]-4-hydroxypiperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155031266) has the molecular formula C42H52FN5O5 and a molecular weight of 725.91 g/mol. Its IUPAC name is 3-[6-[4-[[1-[4-(6-fluoro-6-phenylmethoxyhexan-2-yl)phenyl]-4-hydroxypiperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[1-[4-(6-fluoro-6-phenylmethoxyhexan-2-yl)phenyl]-4-hydroxypiperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155031266 |
| Molecular Formula | C42H52FN5O5 |
| Molecular Weight | 725.91 g/mol |
| Exact Mass | 725.40 |
| IUPAC Name | 3-[6-[4-[[1-[4-(6-fluoro-6-phenylmethoxyhexan-2-yl)phenyl]-4-hydroxypiperidin-4-yl]methyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(CCCC(F)OCc1ccccc1)c1ccc(N2CCC(O)(CN3CCN(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C42H52FN5O5/c1-30(6-5-9-38(43)53-28-31-7-3-2-4-8-31)32-10-12-34(13-11-32)46-20-18-42(52,19-21-46)29-45-22-24-47(25-23-45)35-14-15-36-33(26-35)27-48(41(36)51)37-16-17-39(49)44-40(37)50/h2-4,7-8,10-15,26,30,37-38,52H,5-6,9,16-25,27-29H2,1H3,(H,44,49,50) |
| InChIKey | VOVBMHZYHONFBD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|