C35H34BrNO2 — CID 155031493
(5R)-5-[4-[5-(5-bromo-1H-indol-3-yl)pentoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 155031493) has the molecular formula C35H34BrNO2 and a molecular weight of 580.57 g/mol. Its IUPAC name is (5R)-5-[4-[5-(5-bromo-1H-indol-3-yl)pentoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R)-5-[4-[5-(5-bromo-1H-indol-3-yl)pentoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 155031493 |
| Molecular Formula | C35H34BrNO2 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | (5R)-5-[4-[5-(5-bromo-1H-indol-3-yl)pentoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)CCC(c1ccccc1)[C@@H]2c1ccc(OCCCCCc2c[nH]c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C35H34BrNO2/c36-28-13-19-34-33(22-28)27(23-37-34)9-5-2-6-20-39-30-15-10-25(11-16-30)35-31(24-7-3-1-4-8-24)17-12-26-21-29(38)14-18-32(26)35/h1,3-4,7-8,10-11,13-16,18-19,21-23,31,35,37-38H,2,5-6,9,12,17,20H2/t31?,35-/m0/s1 |
| InChIKey | PWYFIMVWXNCLOB-IKAUJVHPSA-N |
| XLogP | 9.29 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|