C22H24F7NOS — CID 155031554
(3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(thian-4-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide (PubChem CID 155031554) has the molecular formula C22H24F7NOS and a molecular weight of 483.49 g/mol. Its IUPAC name is (3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(thian-4-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | (3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(thian-4-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 155031554 |
| Molecular Formula | C22H24F7NOS |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | (3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(thian-4-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
| SMILES | O=C(NC1CCSCC1)[C@@H]1CCC2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC21 |
| InChI | InChI=1S/C22H24F7NOS/c23-20(21(24,25)26,22(27,28)29)13-2-4-15-12(11-13)1-3-17-16(15)5-6-18(17)19(31)30-14-7-9-32-10-8-14/h2,4,11,14,16-18H,1,3,5-10H2,(H,30,31)/t16?,17?,18-/m1/s1 |
| InChIKey | JYXXEIQPEWCNTC-DAWZGUTISA-N |
| XLogP | 6.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |