C23H22F2N4O4S — CID 155031835
methyl 2-[(2,4-difluorophenyl)sulfonylamino]-N-[(E)-2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-7-yl)but-1-enyl]prop-2-enimidate (PubChem CID 155031835) has the molecular formula C23H22F2N4O4S and a molecular weight of 488.52 g/mol. Its IUPAC name is methyl 2-[(2,4-difluorophenyl)sulfonylamino]-N-[(E)-2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-7-yl)but-1-enyl]prop-2-enimidate.
| Compound Name | methyl 2-[(2,4-difluorophenyl)sulfonylamino]-N-[(E)-2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-7-yl)but-1-enyl]prop-2-enimidate |
|---|---|
| PubChem CID | 155031835 |
| Molecular Formula | C23H22F2N4O4S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | methyl 2-[(2,4-difluorophenyl)sulfonylamino]-N-[(E)-2-(8-methyl-4-oxopyrido[1,2-a]pyrimidin-7-yl)but-1-enyl]prop-2-enimidate |
| SMILES | C=C(NS(=O)(=O)c1ccc(F)cc1F)/C(=N/C=C(\CC)c1cn2c(=O)ccnc2cc1C)OC |
| InChI | InChI=1S/C23H22F2N4O4S/c1-5-16(18-13-29-21(10-14(18)2)26-9-8-22(29)30)12-27-23(33-4)15(3)28-34(31,32)20-7-6-17(24)11-19(20)25/h6-13,28H,3,5H2,1-2,4H3/b16-12+,27-23- |
| InChIKey | DAONFSIFZJBQTC-CYJNVMDVSA-N |
| XLogP | 3.57 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|