C22H22N4O3 — CID 155032378
5-[6-(cyclopropylmethoxy)-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-2-yl]-1,3-benzoxazol-2-amine (PubChem CID 155032378) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-[6-(cyclopropylmethoxy)-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-2-yl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-[6-(cyclopropylmethoxy)-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-2-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 155032378 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-[6-(cyclopropylmethoxy)-9-oxa-1,3-diazatricyclo[6.5.1.04,14]tetradeca-2,4(14),5,7-tetraen-2-yl]-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2cc(-c3nc4cc(OCC5CC5)cc5c4n3CCCCO5)ccc2o1 |
| InChI | InChI=1S/C22H22N4O3/c23-22-25-16-9-14(5-6-18(16)29-22)21-24-17-10-15(28-12-13-3-4-13)11-19-20(17)26(21)7-1-2-8-27-19/h5-6,9-11,13H,1-4,7-8,12H2,(H2,23,25) |
| InChIKey | CZWRWRYLXBUGOC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |