C23H23N3O — CID 155032878
7-[(4-aminonaphthalen-1-yl)iminomethyl]-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol (PubChem CID 155032878) has the molecular formula C23H23N3O and a molecular weight of 357.46 g/mol. Its IUPAC name is 7-[(4-aminonaphthalen-1-yl)iminomethyl]-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol.
| Compound Name | 7-[(4-aminonaphthalen-1-yl)iminomethyl]-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol |
|---|---|
| PubChem CID | 155032878 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 7-[(4-aminonaphthalen-1-yl)iminomethyl]-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-6-ol |
| SMILES | Nc1ccc(/N=C/c2cc3c4c(c2O)CCCN4CCC3)c2ccccc12 |
| InChI | InChI=1S/C23H23N3O/c24-20-9-10-21(18-7-2-1-6-17(18)20)25-14-16-13-15-5-3-11-26-12-4-8-19(22(15)26)23(16)27/h1-2,6-7,9-10,13-14,27H,3-5,8,11-12,24H2/b25-14+ |
| InChIKey | XFTURTPQUGXDBM-AFUMVMLFSA-N |
| XLogP | 4.58 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|