C25H19N3O2S — CID 155033037
(E)-2-cyano-3-[4-[4-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazol-7-yl]phenyl]prop-2-enoic acid (PubChem CID 155033037) has the molecular formula C25H19N3O2S and a molecular weight of 425.51 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[4-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazol-7-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[4-[4-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazol-7-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155033037 |
| Molecular Formula | C25H19N3O2S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (E)-2-cyano-3-[4-[4-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazol-7-yl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C)c(-c2ccc(-c3ccc(/C=C(\C#N)C(=O)O)cc3)c3nsnc23)c(C)c1 |
| InChI | InChI=1S/C25H19N3O2S/c1-14-10-15(2)22(16(3)11-14)21-9-8-20(23-24(21)28-31-27-23)18-6-4-17(5-7-18)12-19(13-26)25(29)30/h4-12H,1-3H3,(H,29,30)/b19-12+ |
| InChIKey | LLCGZLFCWHYHBX-XDHOZWIPSA-N |
| XLogP | 5.94 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|