C22H17FN4O2 — CID 155033045
6-benzyl-3-(2-fluoro-4-pyridinyl)-1,5,6,9-tetrahydropyrazolo[4,5-h][3,1]benzoxazepin-8-one (PubChem CID 155033045) has the molecular formula C22H17FN4O2 and a molecular weight of 388.40 g/mol. Its IUPAC name is 6-benzyl-3-(2-fluoro-4-pyridinyl)-1,5,6,9-tetrahydropyrazolo[4,5-h][3,1]benzoxazepin-8-one.
| Compound Name | 6-benzyl-3-(2-fluoro-4-pyridinyl)-1,5,6,9-tetrahydropyrazolo[4,5-h][3,1]benzoxazepin-8-one |
|---|---|
| PubChem CID | 155033045 |
| Molecular Formula | C22H17FN4O2 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 6-benzyl-3-(2-fluoro-4-pyridinyl)-1,5,6,9-tetrahydropyrazolo[4,5-h][3,1]benzoxazepin-8-one |
| SMILES | O=C1Nc2cc3[nH]nc(-c4ccnc(F)c4)c3cc2CC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H17FN4O2/c23-20-11-14(6-7-24-20)21-17-10-15-9-16(8-13-4-2-1-3-5-13)29-22(28)25-18(15)12-19(17)26-27-21/h1-7,10-12,16H,8-9H2,(H,25,28)(H,26,27) |
| InChIKey | USIBXFWJKVLIOP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|