C27H31N3O — CID 155033278
7-[(4-aminonaphthalen-1-yl)iminomethyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol (PubChem CID 155033278) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is 7-[(4-aminonaphthalen-1-yl)iminomethyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol.
| Compound Name | 7-[(4-aminonaphthalen-1-yl)iminomethyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol |
|---|---|
| PubChem CID | 155033278 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 7-[(4-aminonaphthalen-1-yl)iminomethyl]-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-6-ol |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c(O)c(/C=N/c4ccc(N)c5ccccc45)cc1c32 |
| InChI | InChI=1S/C27H31N3O/c1-26(2)11-13-30-14-12-27(3,4)23-24(30)20(26)15-17(25(23)31)16-29-22-10-9-21(28)18-7-5-6-8-19(18)22/h5-10,15-16,31H,11-14,28H2,1-4H3/b29-16+ |
| InChIKey | GQTJOMSUOADVMI-MUFRIFMGSA-N |
| XLogP | 6.05 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|