C23H22FN3O2 — CID 155033514
2-[3-fluoro-5-prop-2-enyl-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one (PubChem CID 155033514) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[3-fluoro-5-prop-2-enyl-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[3-fluoro-5-prop-2-enyl-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 155033514 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[3-fluoro-5-prop-2-enyl-4-[(2R)-pyrrolidin-2-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-one |
| SMILES | C=CCc1cc(-c2[nH]c3cccc4c3c2CONC4=O)cc(F)c1[C@H]1CCCN1 |
| InChI | InChI=1S/C23H22FN3O2/c1-2-5-13-10-14(11-17(24)20(13)18-8-4-9-25-18)22-16-12-29-27-23(28)15-6-3-7-19(26-22)21(15)16/h2-3,6-7,10-11,18,25-26H,1,4-5,8-9,12H2,(H,27,28)/t18-/m1/s1 |
| InChIKey | RQOVGKTXUBZHTN-GOSISDBHSA-N |
| XLogP | 4.30 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|