C15H26O2 — CID 155033525
(3Z)-3-[(E)-but-2-enylidene]-8,8-dimethylnon-1-ene-2,7-diol (PubChem CID 155033525) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (3Z)-3-[(E)-but-2-enylidene]-8,8-dimethylnon-1-ene-2,7-diol.
| Compound Name | (3Z)-3-[(E)-but-2-enylidene]-8,8-dimethylnon-1-ene-2,7-diol |
|---|---|
| PubChem CID | 155033525 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3Z)-3-[(E)-but-2-enylidene]-8,8-dimethylnon-1-ene-2,7-diol |
| SMILES | C=C(O)/C(=C\C=C\C)CCCC(O)C(C)(C)C |
| InChI | InChI=1S/C15H26O2/c1-6-7-9-13(12(2)16)10-8-11-14(17)15(3,4)5/h6-7,9,14,16-17H,2,8,10-11H2,1,3-5H3/b7-6+,13-9- |
| InChIKey | UHBYHMUHPAECFB-PXBDENQTSA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|