C21H21F2N3O2 — CID 155033796
6-fluoro-2-[3-fluoro-4-[(3R)-piperidin-3-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-ol (PubChem CID 155033796) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is 6-fluoro-2-[3-fluoro-4-[(3R)-piperidin-3-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-ol.
| Compound Name | 6-fluoro-2-[3-fluoro-4-[(3R)-piperidin-3-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-ol |
|---|---|
| PubChem CID | 155033796 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 6-fluoro-2-[3-fluoro-4-[(3R)-piperidin-3-yl]phenyl]-11-oxa-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-9-ol |
| SMILES | OC1NOCc2c(-c3ccc([C@H]4CCCNC4)c(F)c3)[nH]c3cc(F)cc1c23 |
| InChI | InChI=1S/C21H21F2N3O2/c22-13-7-15-19-16(10-28-26-21(15)27)20(25-18(19)8-13)11-3-4-14(17(23)6-11)12-2-1-5-24-9-12/h3-4,6-8,12,21,24-27H,1-2,5,9-10H2/t12-,21?/m0/s1 |
| InChIKey | XCJCJXQXRLUBSB-SXWUCCAISA-N |
| XLogP | 3.61 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |