About 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane
7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 155034400) has the molecular formula C19H35F2N3
and a molecular weight of 343.51 g/mol. Its IUPAC name is 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 155034400 |
| Molecular Formula | C19H35F2N3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | CCCN1CCC(CN2CCC3(CC2)CN(C(C)C)C3)C(F)(F)C1 |
| InChI | InChI=1S/C19H35F2N3/c1-4-8-23-9-5-17(19(20,21)15-23)12-22-10-6-18(7-11-22)13-24(14-18)16(2)3/h16-17H,4-15H2,1-3H3 |
| InChIKey | ZBEOAOQLWXHMKE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane (CID 155034400) is 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane is CCCN1CCC(CN2CCC3(CC2)CN(C(C)C)C3)C(F)(F)C1.
What is the InChIKey of 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane?
The InChIKey is ZBEOAOQLWXHMKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35F2N3/c1-4-8-23-9-5-17(19(20,21)15-23)12-22-10-6-18(7-11-22)13-24(14-18)16(2)3/h16-17H,4-15H2,1-3H3.
What are the key properties of 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane?
7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane has a molecular weight of 343.51 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,3-difluoro-1-propylpiperidin-4-yl)methyl]-2-propan-2-yl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 155034400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).