C32H53NO4 — CID 155034858
2-methylpropyl N-[(2S)-4-[(1R,4S,9S,13S,16S)-16-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-6-yl]-2-methylbutyl]carbamate (PubChem CID 155034858) has the molecular formula C32H53NO4 and a molecular weight of 515.78 g/mol. Its IUPAC name is 2-methylpropyl N-[(2S)-4-[(1R,4S,9S,13S,16S)-16-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-6-yl]-2-methylbutyl]carbamate.
| Compound Name | 2-methylpropyl N-[(2S)-4-[(1R,4S,9S,13S,16S)-16-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-6-yl]-2-methylbutyl]carbamate |
|---|---|
| PubChem CID | 155034858 |
| Molecular Formula | C32H53NO4 |
| Molecular Weight | 515.78 g/mol |
| Exact Mass | 515.40 |
| IUPAC Name | 2-methylpropyl N-[(2S)-4-[(1R,4S,9S,13S,16S)-16-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-6-yl]-2-methylbutyl]carbamate |
| SMILES | CC1=C(CC[C@H](C)CNC(=O)OCC(C)C)O[C@H]2CC3[C@@H]4CCC5C[C@@H](O)CC[C@]5(C)C4CC[C@]3(C)C12 |
| InChI | InChI=1S/C32H53NO4/c1-19(2)18-36-30(35)33-17-20(3)7-10-27-21(4)29-28(37-27)16-26-24-9-8-22-15-23(34)11-13-31(22,5)25(24)12-14-32(26,29)6/h19-20,22-26,28-29,34H,7-18H2,1-6H3,(H,33,35)/t20-,22?,23-,24+,25?,26?,28-,29?,31-,32-/m0/s1 |
| InChIKey | YBIKBRFGKQIKNS-MAEMQEFASA-N |
| XLogP | 7.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |