About 4-heptan-3-ylpyrido[3,2-d]pyrimidine
4-heptan-3-ylpyrido[3,2-d]pyrimidine (PubChem CID 155035105) has the molecular formula C14H19N3
and a molecular weight of 229.33 g/mol. Its IUPAC name is 4-heptan-3-ylpyrido[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-heptan-3-ylpyrido[3,2-d]pyrimidine |
| PubChem CID | 155035105 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 4-heptan-3-ylpyrido[3,2-d]pyrimidine |
| SMILES | CCCCC(CC)c1ncnc2cccnc12 |
| InChI | InChI=1S/C14H19N3/c1-3-5-7-11(4-2)13-14-12(16-10-17-13)8-6-9-15-14/h6,8-11H,3-5,7H2,1-2H3 |
| InChIKey | HMSVSVNDNMOXOQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-heptan-3-ylpyrido[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptan-3-ylpyrido[3,2-d]pyrimidine?
The IUPAC name of 4-heptan-3-ylpyrido[3,2-d]pyrimidine (CID 155035105) is 4-heptan-3-ylpyrido[3,2-d]pyrimidine.
What is the SMILES notation for 4-heptan-3-ylpyrido[3,2-d]pyrimidine?
The canonical SMILES for 4-heptan-3-ylpyrido[3,2-d]pyrimidine is CCCCC(CC)c1ncnc2cccnc12.
What is the InChIKey of 4-heptan-3-ylpyrido[3,2-d]pyrimidine?
The InChIKey is HMSVSVNDNMOXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3/c1-3-5-7-11(4-2)13-14-12(16-10-17-13)8-6-9-15-14/h6,8-11H,3-5,7H2,1-2H3.
What are the key properties of 4-heptan-3-ylpyrido[3,2-d]pyrimidine?
4-heptan-3-ylpyrido[3,2-d]pyrimidine has a molecular weight of 229.33 g/mol, XLogP of 3.71, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptan-3-ylpyrido[3,2-d]pyrimidine is sourced from PubChem (CID 155035105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).