C26H38O5 — CID 155035440
5'-[2-(5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene)ethyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one (PubChem CID 155035440) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 5'-[2-(5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene)ethyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one.
| Compound Name | 5'-[2-(5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene)ethyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
|---|---|
| PubChem CID | 155035440 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 5'-[2-(5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-ylidene)ethyl]spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
| SMILES | CC1(C)COC2(CC3CC(=CCC4COC5(CC6CC(=O)CC6C5)OC4)CC3C2)OC1 |
| InChI | InChI=1S/C26H38O5/c1-24(2)15-30-26(31-16-24)9-19-5-17(6-20(19)10-26)3-4-18-13-28-25(29-14-18)11-21-7-23(27)8-22(21)12-25/h3,18-22H,4-16H2,1-2H3 |
| InChIKey | MSVSXMZGBSWDCZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|