C24H35FN2O5 — CID 155035954
tert-butyl N-[(1S)-1-cycloheptyl-2-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]anilino]-2-oxoethyl]carbamate (PubChem CID 155035954) has the molecular formula C24H35FN2O5 and a molecular weight of 450.55 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-cycloheptyl-2-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-cycloheptyl-2-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 155035954 |
| Molecular Formula | C24H35FN2O5 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl N-[(1S)-1-cycloheptyl-2-[2-fluoro-4-[(2S,3R)-3-hydroxy-4-oxobutan-2-yl]anilino]-2-oxoethyl]carbamate |
| SMILES | C[C@@H](c1ccc(NC(=O)[C@@H](NC(=O)OC(C)(C)C)C2CCCCCC2)c(F)c1)[C@@H](O)C=O |
| InChI | InChI=1S/C24H35FN2O5/c1-15(20(29)14-28)17-11-12-19(18(25)13-17)26-22(30)21(16-9-7-5-6-8-10-16)27-23(31)32-24(2,3)4/h11-16,20-21,29H,5-10H2,1-4H3,(H,26,30)(H,27,31)/t15-,20-,21-/m0/s1 |
| InChIKey | CMJPAKTVMOSLGG-JHVJFLLYSA-N |
| XLogP | 4.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|