About (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane
(2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane (PubChem CID 155036229) has the molecular formula C13H27FN2
and a molecular weight of 230.37 g/mol. Its IUPAC name is (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane.
Molecular Properties
| Compound Name | (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane |
| PubChem CID | 155036229 |
| Molecular Formula | C13H27FN2 |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane |
| SMILES | CN1C(F)CCN(C(C)(C)C)[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C13H27FN2/c1-12(2,3)11-15(7)10(14)8-9-16(11)13(4,5)6/h10-11H,8-9H2,1-7H3/t10?,11-/m1/s1 |
| InChIKey | GZBKJFREYYWCBU-RRKGBCIJSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane?
The IUPAC name of (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane (CID 155036229) is (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane.
What is the SMILES notation for (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane?
The canonical SMILES for (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane is CN1C(F)CCN(C(C)(C)C)[C@@H]1C(C)(C)C.
What is the InChIKey of (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane?
The InChIKey is GZBKJFREYYWCBU-RRKGBCIJSA-N. The full InChI is InChI=1S/C13H27FN2/c1-12(2,3)11-15(7)10(14)8-9-16(11)13(4,5)6/h10-11H,8-9H2,1-7H3/t10?,11-/m1/s1.
What are the key properties of (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane?
(2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane has a molecular weight of 230.37 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-ditert-butyl-4-fluoro-3-methyl-1,3-diazinane is sourced from PubChem (CID 155036229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).