C29H32N4O2S — CID 155036790
1-tert-butyl-N-[2-[[4-[3-[(1E,5Z,7Z)-5-methylcycloocta-1,5,7-trien-1-yl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]pyrrole-3-carboxamide (PubChem CID 155036790) has the molecular formula C29H32N4O2S and a molecular weight of 500.67 g/mol. Its IUPAC name is 1-tert-butyl-N-[2-[[4-[3-[(1E,5Z,7Z)-5-methylcycloocta-1,5,7-trien-1-yl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]pyrrole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[2-[[4-[3-[(1E,5Z,7Z)-5-methylcycloocta-1,5,7-trien-1-yl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 155036790 |
| Molecular Formula | C29H32N4O2S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 1-tert-butyl-N-[2-[[4-[3-[(1E,5Z,7Z)-5-methylcycloocta-1,5,7-trien-1-yl]phenyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]pyrrole-3-carboxamide |
| SMILES | C/C1=C/C=C\C(c2cccc(-c3csc(NC(=O)CNC(=O)c4ccn(C(C)(C)C)c4)n3)c2)=C/CC1 |
| InChI | InChI=1S/C29H32N4O2S/c1-20-8-5-10-21(11-6-9-20)22-12-7-13-23(16-22)25-19-36-28(31-25)32-26(34)17-30-27(35)24-14-15-33(18-24)29(2,3)4/h5,7-8,10-16,18-19H,6,9,17H2,1-4H3,(H,30,35)(H,31,32,34)/b10-5-,20-8-,21-11+ |
| InChIKey | MIQZQXQEYCCXHH-ICTWYXBWSA-N |
| XLogP | 6.41 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |