About N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide
N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide (PubChem CID 155036845) has the molecular formula C11H18F2N2O2
and a molecular weight of 248.27 g/mol. Its IUPAC name is N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide |
| PubChem CID | 155036845 |
| Molecular Formula | C11H18F2N2O2 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide |
| SMILES | CC(=O)N1CCC(NC(=O)C(C)C)C(F)(F)C1 |
| InChI | InChI=1S/C11H18F2N2O2/c1-7(2)10(17)14-9-4-5-15(8(3)16)6-11(9,12)13/h7,9H,4-6H2,1-3H3,(H,14,17) |
| InChIKey | XKRQTZOHHOMUCF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide?
The IUPAC name of N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide (CID 155036845) is N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide.
What is the SMILES notation for N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide?
The canonical SMILES for N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide is CC(=O)N1CCC(NC(=O)C(C)C)C(F)(F)C1.
What is the InChIKey of N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide?
The InChIKey is XKRQTZOHHOMUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2O2/c1-7(2)10(17)14-9-4-5-15(8(3)16)6-11(9,12)13/h7,9H,4-6H2,1-3H3,(H,14,17).
What are the key properties of N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide?
N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide has a molecular weight of 248.27 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-acetyl-3,3-difluoropiperidin-4-yl)-2-methylpropanamide is sourced from PubChem (CID 155036845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).