About (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine
(Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine (PubChem CID 155037579) has the molecular formula C12H14BrF2N
and a molecular weight of 290.15 g/mol. Its IUPAC name is (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine |
| PubChem CID | 155037579 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine |
| SMILES | N/C(=C\CCCC(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H14BrF2N/c13-10-5-3-4-9(8-10)11(16)6-1-2-7-12(14)15/h3-6,8,12H,1-2,7,16H2/b11-6- |
| InChIKey | YNDOERKAUIKXAG-WDZFZDKYSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine?
The IUPAC name of (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine (CID 155037579) is (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine.
What is the SMILES notation for (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine?
The canonical SMILES for (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine is N/C(=C\CCCC(F)F)c1cccc(Br)c1.
What is the InChIKey of (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine?
The InChIKey is YNDOERKAUIKXAG-WDZFZDKYSA-N. The full InChI is InChI=1S/C12H14BrF2N/c13-10-5-3-4-9(8-10)11(16)6-1-2-7-12(14)15/h3-6,8,12H,1-2,7,16H2/b11-6-.
What are the key properties of (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine?
(Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine has a molecular weight of 290.15 g/mol, XLogP of 4.18, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3-bromophenyl)-6,6-difluorohex-1-en-1-amine is sourced from PubChem (CID 155037579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).