C17H14N2O — CID 155037922
1-[4-(3-phenyl-1H-pyrazol-5-yl)phenyl]ethanone (PubChem CID 155037922) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-[4-(3-phenyl-1H-pyrazol-5-yl)phenyl]ethanone.
| Compound Name | 1-[4-(3-phenyl-1H-pyrazol-5-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 155037922 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-[4-(3-phenyl-1H-pyrazol-5-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H14N2O/c1-12(20)13-7-9-15(10-8-13)17-11-16(18-19-17)14-5-3-2-4-6-14/h2-11H,1H3,(H,18,19) |
| InChIKey | WJNYZXQOKDVSBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |