About (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol
(1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol (PubChem CID 15503821) has the molecular formula C30H32OSi
and a molecular weight of 436.67 g/mol. Its IUPAC name is (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol |
| PubChem CID | 15503821 |
| Molecular Formula | C30H32OSi |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C30H32OSi/c1-30(2,3)32(26-20-12-6-13-21-26,27-22-14-7-15-23-27)29(25-18-10-5-11-19-25)28(31)24-16-8-4-9-17-24/h4-23,28-29,31H,1-3H3/t28-,29+/m1/s1 |
| InChIKey | ZLYVPYPPMFVZEQ-WDYNHAJCSA-N |
| XLogP | 6.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol?
The IUPAC name of (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol (CID 15503821) is (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol.
What is the SMILES notation for (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol?
The canonical SMILES for (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol is CC(C)(C)[Si](c1ccccc1)(c1ccccc1)[C@@H](c1ccccc1)[C@H](O)c1ccccc1.
What is the InChIKey of (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol?
The InChIKey is ZLYVPYPPMFVZEQ-WDYNHAJCSA-N. The full InChI is InChI=1S/C30H32OSi/c1-30(2,3)32(26-20-12-6-13-21-26,27-22-14-7-15-23-27)29(25-18-10-5-11-19-25)28(31)24-16-8-4-9-17-24/h4-23,28-29,31H,1-3H3/t28-,29+/m1/s1.
What are the key properties of (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol?
(1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol has a molecular weight of 436.67 g/mol, XLogP of 6.11, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-[tert-butyl(diphenyl)silyl]-1,2-diphenylethanol is sourced from PubChem (CID 15503821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).