C33H29F2N5O3 — CID 155038336
2-[3-[6-(difluoromethoxy)-5-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-6-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)benzonitrile (PubChem CID 155038336) has the molecular formula C33H29F2N5O3 and a molecular weight of 581.62 g/mol. Its IUPAC name is 2-[3-[6-(difluoromethoxy)-5-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-6-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)benzonitrile.
| Compound Name | 2-[3-[6-(difluoromethoxy)-5-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-6-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 155038336 |
| Molecular Formula | C33H29F2N5O3 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 2-[3-[6-(difluoromethoxy)-5-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-yl]-2-methylphenyl]-6-(4,5,6,7-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-yl)benzonitrile |
| SMILES | Cc1c(-c2nc3cc(CC4CCCN4)c(OC(F)F)cc3o2)cccc1-c1cccc(-c2nc3c(o2)CCNC3)c1C#N |
| InChI | InChI=1S/C33H29F2N5O3/c1-18-21(23-8-3-9-24(25(23)16-36)32-40-27-17-37-12-10-28(27)41-32)6-2-7-22(18)31-39-26-14-19(13-20-5-4-11-38-20)29(43-33(34)35)15-30(26)42-31/h2-3,6-9,14-15,20,33,37-38H,4-5,10-13,17H2,1H3 |
| InChIKey | RAJZSANVMWITLZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |