About N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride
N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride (PubChem CID 155038598) has the molecular formula C9H15FN2
and a molecular weight of 170.23 g/mol. Its IUPAC name is N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride.
Molecular Properties
| Compound Name | N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride |
| PubChem CID | 155038598 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride |
| SMILES | C=N/C(F)=N/C=C(\C)C(C)(C)C |
| InChI | InChI=1S/C9H15FN2/c1-7(9(2,3)4)6-12-8(10)11-5/h6H,5H2,1-4H3/b7-6+,12-8+ |
| InChIKey | JDFGUQXJAQZIHZ-ZYUHXDNHSA-N |
| XLogP | 2.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride?
The IUPAC name of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride (CID 155038598) is N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride.
What is the SMILES notation for N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride?
The canonical SMILES for N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride is C=N/C(F)=N/C=C(\C)C(C)(C)C.
What is the InChIKey of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride?
The InChIKey is JDFGUQXJAQZIHZ-ZYUHXDNHSA-N. The full InChI is InChI=1S/C9H15FN2/c1-7(9(2,3)4)6-12-8(10)11-5/h6H,5H2,1-4H3/b7-6+,12-8+.
What are the key properties of N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride?
N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride has a molecular weight of 170.23 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-N'-[(E)-2,3,3-trimethylbut-1-enyl]carbamimidoyl fluoride is sourced from PubChem (CID 155038598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).