About 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene
1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene (PubChem CID 155038613) has the molecular formula C13H20F2O2
and a molecular weight of 246.30 g/mol. Its IUPAC name is 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene |
| PubChem CID | 155038613 |
| Molecular Formula | C13H20F2O2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene |
| SMILES | CC(C)COCCOC1=C(F)CC(C)C=C1F |
| InChI | InChI=1S/C13H20F2O2/c1-9(2)8-16-4-5-17-13-11(14)6-10(3)7-12(13)15/h6,9-10H,4-5,7-8H2,1-3H3 |
| InChIKey | FOMRIYUAXQKXAW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene?
The IUPAC name of 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene (CID 155038613) is 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene.
What is the SMILES notation for 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene?
The canonical SMILES for 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene is CC(C)COCCOC1=C(F)CC(C)C=C1F.
What is the InChIKey of 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene?
The InChIKey is FOMRIYUAXQKXAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2O2/c1-9(2)8-16-4-5-17-13-11(14)6-10(3)7-12(13)15/h6,9-10H,4-5,7-8H2,1-3H3.
What are the key properties of 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene?
1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene has a molecular weight of 246.30 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoro-5-methyl-2-[2-(2-methylpropoxy)ethoxy]cyclohexa-1,3-diene is sourced from PubChem (CID 155038613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).