C12H15F7O2Si — CID 15503928
2,2,3,3,4,4,4-heptafluoro-1-(2-trimethylsilyloxycyclopenten-1-yl)butan-1-one (PubChem CID 15503928) has the molecular formula C12H15F7O2Si and a molecular weight of 352.32 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(2-trimethylsilyloxycyclopenten-1-yl)butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(2-trimethylsilyloxycyclopenten-1-yl)butan-1-one |
|---|---|
| PubChem CID | 15503928 |
| Molecular Formula | C12H15F7O2Si |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(2-trimethylsilyloxycyclopenten-1-yl)butan-1-one |
| SMILES | C[Si](C)(C)OC1=C(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C12H15F7O2Si/c1-22(2,3)21-8-6-4-5-7(8)9(20)10(13,14)11(15,16)12(17,18)19/h4-6H2,1-3H3 |
| InChIKey | KNCVWKMCNMDWQE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|