C61H41N7O — CID 155039379
(2E)-2-[(Z)-but-2-enylidene]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylideneindole (PubChem CID 155039379) has the molecular formula C61H41N7O and a molecular weight of 888.05 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylideneindole.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylideneindole |
|---|---|
| PubChem CID | 155039379 |
| Molecular Formula | C61H41N7O |
| Molecular Weight | 888.05 g/mol |
| Exact Mass | 887.34 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-5-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-1-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methylideneindole |
| SMILES | C=c1/c(=C\C=C/C)n(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)c2ccc(-c3ccc4oc5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5c4c3)cc12 |
| InChI | InChI=1S/C61H41N7O/c1-3-4-27-51-39(2)49-37-45(31-35-52(49)68(51)47-33-29-44(30-34-47)60-63-56(40-18-9-5-10-19-40)62-57(64-60)41-20-11-6-12-21-41)46-32-36-53-50(38-46)55-48(26-17-28-54(55)69-53)61-66-58(42-22-13-7-14-23-42)65-59(67-61)43-24-15-8-16-25-43/h3-38H,2H2,1H3/b4-3-,51-27+ |
| InChIKey | UTNXSEMMBNTNKU-XCTYFUJUSA-N |
| XLogP | 13.34 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.05 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |