C37H25N5O5S2 — CID 155040559
5-[4-[4-[[5-(1H-indol-6-yl)thiophene-2-carbonyl]amino]phenyl]peroxyphenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiophene-2-carboxamide (PubChem CID 155040559) has the molecular formula C37H25N5O5S2 and a molecular weight of 683.77 g/mol. Its IUPAC name is 5-[4-[4-[[5-(1H-indol-6-yl)thiophene-2-carbonyl]amino]phenyl]peroxyphenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiophene-2-carboxamide.
| Compound Name | 5-[4-[4-[[5-(1H-indol-6-yl)thiophene-2-carbonyl]amino]phenyl]peroxyphenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155040559 |
| Molecular Formula | C37H25N5O5S2 |
| Molecular Weight | 683.77 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | 5-[4-[4-[[5-(1H-indol-6-yl)thiophene-2-carbonyl]amino]phenyl]peroxyphenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1ccc(-c2ccc(OOc3ccc(NC(=O)c4ccc(-c5ccc6cc[nH]c6c5)s4)cc3)cc2)s1 |
| InChI | InChI=1S/C37H25N5O5S2/c43-35(33-16-14-32(49-33)23-2-1-21-17-18-38-29(21)19-23)39-24-5-10-27(11-6-24)47-46-26-8-3-22(4-9-26)31-13-15-34(48-31)36(44)40-25-7-12-28-30(20-25)42-37(45)41-28/h1-20,38H,(H,39,43)(H,40,44)(H2,41,42,45) |
| InChIKey | CODYSORRBNSJLC-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.77 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|