C13H10N2O — CID 15504063
5-phenyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 15504063) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-phenyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-phenyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 15504063 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-phenyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Cc2cc(-c3ccccc3)cnc2N1 |
| InChI | InChI=1S/C13H10N2O/c16-12-7-10-6-11(8-14-13(10)15-12)9-4-2-1-3-5-9/h1-6,8H,7H2,(H,14,15,16) |
| InChIKey | QVGIGZLDWCWJDZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |