About 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one
5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 15504064) has the molecular formula C15H10N2O
and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| PubChem CID | 15504064 |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Cc2cc(C#Cc3ccccc3)cnc2N1 |
| InChI | InChI=1S/C15H10N2O/c18-14-9-13-8-12(10-16-15(13)17-14)7-6-11-4-2-1-3-5-11/h1-5,8,10H,9H2,(H,16,17,18) |
| InChIKey | MMDNLXDYOHZNDO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The IUPAC name of 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CID 15504064) is 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
What is the SMILES notation for 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The canonical SMILES for 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one is O=C1Cc2cc(C#Cc3ccccc3)cnc2N1.
What is the InChIKey of 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
The InChIKey is MMDNLXDYOHZNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O/c18-14-9-13-8-12(10-16-15(13)17-14)7-6-11-4-2-1-3-5-11/h1-5,8,10H,9H2,(H,16,17,18).
What are the key properties of 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one?
5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one has a molecular weight of 234.26 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-phenylethynyl)-1,3-dihydropyrrolo[2,3-b]pyridin-2-one is sourced from PubChem (CID 15504064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).