C16H25F3N4O2S — CID 155040852
[(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] N-(3,3,3-trifluoro-1-sulfanylpropyl)carbamate (PubChem CID 155040852) has the molecular formula C16H25F3N4O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] N-(3,3,3-trifluoro-1-sulfanylpropyl)carbamate.
| Compound Name | [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] N-(3,3,3-trifluoro-1-sulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 155040852 |
| Molecular Formula | C16H25F3N4O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | [(1R,3S)-3-(5-amino-1-tert-butylpyrazol-3-yl)cyclopentyl] N-(3,3,3-trifluoro-1-sulfanylpropyl)carbamate |
| SMILES | CC(C)(C)n1nc([C@H]2CC[C@@H](OC(=O)NC(S)CC(F)(F)F)C2)cc1N |
| InChI | InChI=1S/C16H25F3N4O2S/c1-15(2,3)23-12(20)7-11(22-23)9-4-5-10(6-9)25-14(24)21-13(26)8-16(17,18)19/h7,9-10,13,26H,4-6,8,20H2,1-3H3,(H,21,24)/t9-,10+,13?/m0/s1 |
| InChIKey | QXCDQAJIEIFLGB-RGPRDZHESA-N |
| XLogP | 3.79 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|