About 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol
2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol (PubChem CID 155041147) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol |
| PubChem CID | 155041147 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol |
| SMILES | CCc1ccc(-c2nnc(C)s2)cc1O |
| InChI | InChI=1S/C11H12N2OS/c1-3-8-4-5-9(6-10(8)14)11-13-12-7(2)15-11/h4-6,14H,3H2,1-2H3 |
| InChIKey | DGDBQJAIWACCNC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
The IUPAC name of 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol (CID 155041147) is 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol.
What is the SMILES notation for 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
The canonical SMILES for 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol is CCc1ccc(-c2nnc(C)s2)cc1O.
What is the InChIKey of 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
The InChIKey is DGDBQJAIWACCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-3-8-4-5-9(6-10(8)14)11-13-12-7(2)15-11/h4-6,14H,3H2,1-2H3.
What are the key properties of 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol?
2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol has a molecular weight of 220.30 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)phenol is sourced from PubChem (CID 155041147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).