About 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol
2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol (PubChem CID 155041202) has the molecular formula C15H14N4O2
and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol.
Molecular Properties
| Compound Name | 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol |
| PubChem CID | 155041202 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol |
| SMILES | CNc1ccc(-c2ccc(-c3cc(C)no3)cc2O)nn1 |
| InChI | InChI=1S/C15H14N4O2/c1-9-7-14(21-19-9)10-3-4-11(13(20)8-10)12-5-6-15(16-2)18-17-12/h3-8,20H,1-2H3,(H,16,18) |
| InChIKey | YJQMXKVMOKBJSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol?
The IUPAC name of 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol (CID 155041202) is 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol.
What is the SMILES notation for 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol?
The canonical SMILES for 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol is CNc1ccc(-c2ccc(-c3cc(C)no3)cc2O)nn1.
What is the InChIKey of 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol?
The InChIKey is YJQMXKVMOKBJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2/c1-9-7-14(21-19-9)10-3-4-11(13(20)8-10)12-5-6-15(16-2)18-17-12/h3-8,20H,1-2H3,(H,16,18).
What are the key properties of 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol?
2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol has a molecular weight of 282.30 g/mol, XLogP of 2.85, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(methylamino)pyridazin-3-yl]-5-(3-methyl-1,2-oxazol-5-yl)phenol is sourced from PubChem (CID 155041202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).