About 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene
2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene (PubChem CID 155041547) has the molecular formula C20H26S
and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene.
Molecular Properties
| Compound Name | 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene |
| PubChem CID | 155041547 |
| Molecular Formula | C20H26S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene |
| SMILES | CC(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)sc1-2 |
| InChI | InChI=1S/C20H26S/c1-12(2)13-8-9-14-15(10-13)20(6,7)16-11-17(19(3,4)5)21-18(14)16/h8-12H,1-7H3 |
| InChIKey | JFIBFZPWCVYIDZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene?
The IUPAC name of 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene (CID 155041547) is 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene.
What is the SMILES notation for 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene?
The canonical SMILES for 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene is CC(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)sc1-2.
What is the InChIKey of 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene?
The InChIKey is JFIBFZPWCVYIDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26S/c1-12(2)13-8-9-14-15(10-13)20(6,7)16-11-17(19(3,4)5)21-18(14)16/h8-12H,1-7H3.
What are the key properties of 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene?
2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene has a molecular weight of 298.50 g/mol, XLogP of 6.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,4-dimethyl-6-propan-2-ylindeno[1,2-b]thiophene is sourced from PubChem (CID 155041547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).